Products 922510-18-7
CAS 922510-18-7 appears in our catalog under these names: 2-Hydroxy Fluorene-d9, >95% (HPLC), 9H–Fluoren–2–ol–d9, 9H-Fluoren-2-ol-d9. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
1,3,4,5,6,7,8,9,9-nonadeuteriofluoren-2-ol (CAS 922510-18-7) is a chemical compound with the molecular formula C13H10O and a molecular weight of 191.27 g/mol. IUPAC name: 1,3,4,5,6,7,8,9,9-nonadeuteriofluoren-2-ol. InChIKey: ZDOIAPGLORMKTR-MFNUZUOVSA-N.
| Molecular formula | C13H10O |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | 1,3,4,5,6,7,8,9,9-nonadeuteriofluoren-2-ol |
| InChIKey | ZDOIAPGLORMKTR-MFNUZUOVSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C3=C(C2([2H])[2H])C(=C(C(=C3[2H])[2H])O)[2H])[2H])[2H] |
Computed by PubChem (NCBI)