CAS 922521-06-0 appears in our catalog under these names: 1-Butyl-2,3-dimethylimidazolium nitrate, 95%, 3–butyl–1,2–dimethyl–1H–imidazol–3–ium nitrate, 1-Butyl-2,3-dimethylimidazolium nitrate, ≥95%, ≥95%, 1-BUTYL-2,3-DIMETHYL-3-IMIDAZOLIUM NITRATE, 97%+(HPLC),RG. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g.
1-butyl-2,3-dimethylimidazol-3-ium nitrate (CAS 922521-06-0) is a chemical compound with the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. IUPAC name: 1-butyl-2,3-dimethylimidazol-3-ium nitrate. InChIKey: JJLAZVCVBALAEL-UHFFFAOYSA-N.
| Molecular formula | C9H17N3O3 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 1-butyl-2,3-dimethylimidazol-3-ium nitrate |
| InChIKey | JJLAZVCVBALAEL-UHFFFAOYSA-N |
| SMILES | CCCCN1C=C[N+](=C1C)C.[N+](=O)([O-])[O-] |
Computed by PubChem (NCBI)