CAS 922706-40-9 appears in our catalog under these names: 2-(2-Fluorenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 2–(2–Fluorenyl)–4,4,5,5–tetramethyl–1,3,2–dioxaborolane, Fluorene-2-boronic acid pinacol ester, 95% , 2-(9H-Fluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >98.0%(GC)(T), 2-(9H-Fluoren-2-yl)-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane, 95%, 95%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 100g.
2-(9H-fluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 922706-40-9) is a chemical compound with the molecular formula C19H21BO2 and a molecular weight of 292.2 g/mol. IUPAC name: 2-(9H-fluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WVJQQLZHOADEAF-UHFFFAOYSA-N.
| Molecular formula | C19H21BO2 |
|---|---|
| Molecular weight | 292.2 g/mol |
| IUPAC name | 2-(9H-fluoren-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WVJQQLZHOADEAF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C4=CC=CC=C4C3 |
Computed by PubChem (NCBI)