CAS 922727-37-5 appears in our catalog under these names: Pantoprazole-d3, Pantoprazole-d3, >95% (HPLC). Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 2mg, 5mg, 1 mg, 10 mg.
6-(difluoromethoxy)-2-[[3-methoxy-4-(trideuteriomethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole (CAS 922727-37-5) is a chemical compound with the molecular formula C16H15F2N3O4S and a molecular weight of 386.4 g/mol. IUPAC name: 6-(difluoromethoxy)-2-[[3-methoxy-4-(trideuteriomethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole. InChIKey: IQPSEEYGBUAQFF-FIBGUPNXSA-N.
| Molecular formula | C16H15F2N3O4S |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 6-(difluoromethoxy)-2-[[3-methoxy-4-(trideuteriomethoxy)-2-pyridinyl]methylsulfinyl]-1H-benzimidazole |
| InChIKey | IQPSEEYGBUAQFF-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C(=NC=C1)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC(F)F)OC |
Computed by PubChem (NCBI)