CAS 922734-43-8 appears in our catalog under these names: Amorolfine Impurity 9, Amorolfine Impurity 3(Amorolfine EP Impurity C), Rel-(2S,6R)-2,6-dimethyl-4-(2-methyl-3-phenylpropyl)morpholine hydrochloride, 98%, (2R,6S)-rel-2,6-Dimethyl-4-(2-methyl-3-phenylpropyl)morpholine Hydrochloride, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5g, 250mg.
(2S,6R)-2,6-dimethyl-4-(2-methyl-3-phenylpropyl)morpholine;hydrochloride (CAS 922734-43-8) is a chemical compound with the molecular formula C16H26ClNO and a molecular weight of 283.83 g/mol. IUPAC name: (2S,6R)-2,6-dimethyl-4-(2-methyl-3-phenylpropyl)morpholine;hydrochloride. InChIKey: OBKSBQUAVIMCMV-XZPOUAKSSA-N.
| Molecular formula | C16H26ClNO |
|---|---|
| Molecular weight | 283.83 g/mol |
| IUPAC name | (2S,6R)-2,6-dimethyl-4-(2-methyl-3-phenylpropyl)morpholine;hydrochloride |
| InChIKey | OBKSBQUAVIMCMV-XZPOUAKSSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)CC(C)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)