CAS 92295-27-7 is the registry number for N-(4-Phenoxyphenyl)imidodicarbonimidic diamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(diaminomethylidene)-2-(4-phenoxyphenyl)guanidine (CAS 92295-27-7) is a chemical compound with the molecular formula C14H15N5O and a molecular weight of 269.30 g/mol. IUPAC name: 1-(diaminomethylidene)-2-(4-phenoxyphenyl)guanidine. InChIKey: GOYRWAVRZBZMIR-UHFFFAOYSA-N.
| Molecular formula | C14H15N5O |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | 1-(diaminomethylidene)-2-(4-phenoxyphenyl)guanidine |
| InChIKey | GOYRWAVRZBZMIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)N=C(N)N=C(N)N |
Computed by PubChem (NCBI)