Products 92295-93-7
CAS 92295-93-7 is the registry number for 3-Bromo-7-(diethylamino)-4-methyl-2H-chromen-2-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
3-bromo-7-(diethylamino)-4-methylchromen-2-one (CAS 92295-93-7) is a chemical compound with the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. IUPAC name: 3-bromo-7-(diethylamino)-4-methylchromen-2-one. InChIKey: ZUEYCRIQERASHX-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO2 |
|---|---|
| Molecular weight | 310.19 g/mol |
| IUPAC name | 3-bromo-7-(diethylamino)-4-methylchromen-2-one |
| InChIKey | ZUEYCRIQERASHX-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C(=C(C(=O)O2)Br)C |
Computed by PubChem (NCBI)