Products 923032-55-7

CAS 923032-55-7 appears in our catalog under these names: 1-Methylcyclopropane-1-sulfonyl chloride, 97%, 1-Methylcyclopropane-1-sulphonyl chloride, 1-Methylcyclopropane-1-sulfonyl chloride 95%, 1-Methylcyclopropane-1-sulfonyl chloride, 95%, 95%, 1-METHYLCYCLOPROPANE-1-SULFONYL CHLORIDE, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 2,5g, 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

1-methylcyclopropane-1-sulfonyl chloride (CAS 923032-55-7) is a chemical compound with the molecular formula C4H7ClO2S and a molecular weight of 154.62 g/mol. IUPAC name: 1-methylcyclopropane-1-sulfonyl chloride. InChIKey: FMDWPLJEKVUGTC-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7ClO2S
Molecular weight154.62 g/mol
IUPAC name1-methylcyclopropane-1-sulfonyl chloride
InChIKeyFMDWPLJEKVUGTC-UHFFFAOYSA-N
SMILESCC1(CC1)S(=O)(=O)Cl

Computed by PubChem (NCBI)