Products 923035-06-7

CAS 923035-06-7 is the registry number for Rivastigmine Impurity 48. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

3-[1-(methylamino)ethyl]phenol (CAS 923035-06-7) is a chemical compound with the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. IUPAC name: 3-[1-(methylamino)ethyl]phenol. InChIKey: AEOMELCUDZBIFY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO
Molecular weight151.21 g/mol
IUPAC name3-[1-(methylamino)ethyl]phenol
InChIKeyAEOMELCUDZBIFY-UHFFFAOYSA-N
SMILESCC(C1=CC(=CC=C1)O)NC

Computed by PubChem (NCBI)