CAS 923178-85-2 is the registry number for 2-((5-Amino-1,3,4-thiadiazol-2-yl)thio)cyclohexan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexan-1-one (CAS 923178-85-2) is a chemical compound with the molecular formula C8H11N3OS2 and a molecular weight of 229.3 g/mol. IUPAC name: 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexan-1-one. InChIKey: KELASVVPVUWYIV-UHFFFAOYSA-N.
| Molecular formula | C8H11N3OS2 |
|---|---|
| Molecular weight | 229.3 g/mol |
| IUPAC name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]cyclohexan-1-one |
| InChIKey | KELASVVPVUWYIV-UHFFFAOYSA-N |
| SMILES | C1CCC(=O)C(C1)SC2=NN=C(S2)N |
Computed by PubChem (NCBI)