CAS 923181-89-9 is the registry number for 4-((2,4-Dimethylphenyl)sulfonyl)piperazin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,4-dimethylphenyl)sulfonylpiperazin-2-one (CAS 923181-89-9) is a chemical compound with the molecular formula C12H16N2O3S and a molecular weight of 268.33 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)sulfonylpiperazin-2-one. InChIKey: GVKJKAXBIZZELU-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O3S |
|---|---|
| Molecular weight | 268.33 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)sulfonylpiperazin-2-one |
| InChIKey | GVKJKAXBIZZELU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)N2CCNC(=O)C2)C |
Computed by PubChem (NCBI)