CAS 923204-80-2 is the registry number for 4-Fluoro-N-methylbenzo[b]thiophene-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-N-methyl-1-benzothiophene-2-carboxamide (CAS 923204-80-2) is a chemical compound with the molecular formula C10H8FNOS and a molecular weight of 209.24 g/mol. IUPAC name: 4-fluoro-N-methyl-1-benzothiophene-2-carboxamide. InChIKey: GKJZTOZHMLFLTD-UHFFFAOYSA-N.
| Molecular formula | C10H8FNOS |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 4-fluoro-N-methyl-1-benzothiophene-2-carboxamide |
| InChIKey | GKJZTOZHMLFLTD-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC2=C(C=CC=C2S1)F |
Computed by PubChem (NCBI)