CAS 923241-29-6 is the registry number for 3,4-Dichloro-1-((3-chlorophenyl)methyl)-2,5-dihydro-1H-pyrrole-2,5-dione. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3,4-dichloro-1-[(3-chlorophenyl)methyl]pyrrole-2,5-dione (CAS 923241-29-6) is a chemical compound with the molecular formula C11H6Cl3NO2 and a molecular weight of 290.5 g/mol. IUPAC name: 3,4-dichloro-1-[(3-chlorophenyl)methyl]pyrrole-2,5-dione. InChIKey: COKVSADPWHRIJA-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl3NO2 |
|---|---|
| Molecular weight | 290.5 g/mol |
| IUPAC name | 3,4-dichloro-1-[(3-chlorophenyl)methyl]pyrrole-2,5-dione |
| InChIKey | COKVSADPWHRIJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CN2C(=O)C(=C(C2=O)Cl)Cl |
Computed by PubChem (NCBI)