CAS 923246-98-4 appears in our catalog under these names: 5-(Aminomethyl)-N,N-dimethylthiophene-2-sulfonamide, 95%, 5-(Aminomethyl)-N,N-dimethylthiophene-2-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
5-(aminomethyl)-N,N-dimethylthiophene-2-sulfonamide (CAS 923246-98-4) is a chemical compound with the molecular formula C7H12N2O2S2 and a molecular weight of 220.3 g/mol. IUPAC name: 5-(aminomethyl)-N,N-dimethylthiophene-2-sulfonamide. InChIKey: QYPDSFRORPTCEV-UHFFFAOYSA-N.
| Molecular formula | C7H12N2O2S2 |
|---|---|
| Molecular weight | 220.3 g/mol |
| IUPAC name | 5-(aminomethyl)-N,N-dimethylthiophene-2-sulfonamide |
| InChIKey | QYPDSFRORPTCEV-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=C(S1)CN |
Computed by PubChem (NCBI)