Products 923248-40-2
CAS 923248-40-2 is the registry number for 4-[(4-Bromo-2-fluorophenyl)methyl]piperazin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-[(4-bromo-2-fluorophenyl)methyl]piperazin-2-one (CAS 923248-40-2) is a chemical compound with the molecular formula C11H12BrFN2O and a molecular weight of 287.13 g/mol. IUPAC name: 4-[(4-bromo-2-fluorophenyl)methyl]piperazin-2-one. InChIKey: PWOOXMDPDXTYKJ-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFN2O |
|---|---|
| Molecular weight | 287.13 g/mol |
| IUPAC name | 4-[(4-bromo-2-fluorophenyl)methyl]piperazin-2-one |
| InChIKey | PWOOXMDPDXTYKJ-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=O)N1)CC2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)