Products 923272-18-8
CAS 923272-18-8 appears in our catalog under these names: AMPA receptor antagonist-3/ 98.24% (existing batch purity), AMPA receptor antagonist–3, AMPA receptor antagonist-3. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg.
2-methyl-4-[(8R)-8-methyl-7-(1,3,4-thiadiazol-2-yl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-5-yl]aniline (CAS 923272-18-8) is a chemical compound with the molecular formula C20H19N5O2S and a molecular weight of 393.5 g/mol. IUPAC name: 2-methyl-4-[(8R)-8-methyl-7-(1,3,4-thiadiazol-2-yl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-5-yl]aniline. InChIKey: HCOJNYUPUOBYDH-GFCCVEGCSA-N.
| Molecular formula | C20H19N5O2S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | 2-methyl-4-[(8R)-8-methyl-7-(1,3,4-thiadiazol-2-yl)-8,9-dihydro-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-5-yl]aniline |
| InChIKey | HCOJNYUPUOBYDH-GFCCVEGCSA-N |
| SMILES | C[C@@H]1CC2=CC3=C(C=C2C(=NN1C4=NN=CS4)C5=CC(=C(C=C5)N)C)OCO3 |
Computed by PubChem (NCBI)
Synonyms:
AMPA receptor antagonist-3, orb1688224