CAS 923569-79-3 is the registry number for 2-(Heptafluoropropyl)-5-methoxy-1H-indole. Offered by: TRC. Available pack sizes: 100mg.
2-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methoxy-1H-indole (CAS 923569-79-3) is a chemical compound with the molecular formula C12H8F7NO and a molecular weight of 315.19 g/mol. IUPAC name: 2-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methoxy-1H-indole. InChIKey: ASWZKBOTOHYLHW-UHFFFAOYSA-N.
| Molecular formula | C12H8F7NO |
|---|---|
| Molecular weight | 315.19 g/mol |
| IUPAC name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-5-methoxy-1H-indole |
| InChIKey | ASWZKBOTOHYLHW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=C2)C(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)