CAS 923571-16-8 appears in our catalog under these names: Donepezil Impurity 16, 1-Benzyl-4-(5,6-dimethoxy-1-oxo-2,3-dihydro-1H-indene-2-carbonyl)pyridin-1-ium chloride, 95%. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
2-(1-benzylpyridin-1-ium-4-carbonyl)-5,6-dimethoxy-2,3-dihydroinden-1-one chloride (CAS 923571-16-8) is a chemical compound with the molecular formula C24H22ClNO4 and a molecular weight of 423.9 g/mol. IUPAC name: 2-(1-benzylpyridin-1-ium-4-carbonyl)-5,6-dimethoxy-2,3-dihydroinden-1-one chloride. InChIKey: ZQKYQNZQKAWSJJ-UHFFFAOYSA-M.
| Molecular formula | C24H22ClNO4 |
|---|---|
| Molecular weight | 423.9 g/mol |
| IUPAC name | 2-(1-benzylpyridin-1-ium-4-carbonyl)-5,6-dimethoxy-2,3-dihydroinden-1-one chloride |
| InChIKey | ZQKYQNZQKAWSJJ-UHFFFAOYSA-M |
| SMILES | COC1=C(C=C2C(=C1)CC(C2=O)C(=O)C3=CC=[N+](C=C3)CC4=CC=CC=C4)OC.[Cl-] |
Computed by PubChem (NCBI)