Products 92358-02-6
CAS 92358-02-6 is the registry number for S-25932. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-fluoro-8-imidazol-1-yl-12-methyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid (CAS 92358-02-6) is a chemical compound with the molecular formula C17H14FN3O3 and a molecular weight of 327.31 g/mol. IUPAC name: 7-fluoro-8-imidazol-1-yl-12-methyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid. InChIKey: NWGIBDONRWWYPV-UHFFFAOYSA-N.
| Molecular formula | C17H14FN3O3 |
|---|---|
| Molecular weight | 327.31 g/mol |
| IUPAC name | 7-fluoro-8-imidazol-1-yl-12-methyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid |
| InChIKey | NWGIBDONRWWYPV-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C3N1C=C(C(=O)C3=CC(=C2N4C=CN=C4)F)C(=O)O |
Computed by PubChem (NCBI)