CAS 92368-12-2 appears in our catalog under these names: 3-PHENOXYBENZENETHIOL, 95%+, 95%+, 3-PHENOXYBENZENETHIOL, 95%+. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-phenoxybenzenethiol (CAS 92368-12-2) is a chemical compound with the molecular formula C12H10OS and a molecular weight of 202.27 g/mol. IUPAC name: 3-phenoxybenzenethiol. InChIKey: XPQCDDICHCCIJE-UHFFFAOYSA-N.
| Molecular formula | C12H10OS |
|---|---|
| Molecular weight | 202.27 g/mol |
| IUPAC name | 3-phenoxybenzenethiol |
| InChIKey | XPQCDDICHCCIJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=CC=C2)S |
Computed by PubChem (NCBI)