CAS 923767-68-4 appears in our catalog under these names: 4-Cyclopropyl-3-(methylsulfonyl)-5-thien-2-yl-4h-1,2,4-triazole, 95%, 4-Cyclopropyl-3-methanesulfonyl-5-(thiophen-2-yl)-4H-1,2,4-triazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-cyclopropyl-3-methylsulfonyl-5-thiophen-2-yl-1,2,4-triazole (CAS 923767-68-4) is a chemical compound with the molecular formula C10H11N3O2S2 and a molecular weight of 269.3 g/mol. IUPAC name: 4-cyclopropyl-3-methylsulfonyl-5-thiophen-2-yl-1,2,4-triazole. InChIKey: MAFMVFBRRQTGED-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2S2 |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 4-cyclopropyl-3-methylsulfonyl-5-thiophen-2-yl-1,2,4-triazole |
| InChIKey | MAFMVFBRRQTGED-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NN=C(N1C2CC2)C3=CC=CS3 |
Computed by PubChem (NCBI)