Products 923863-82-5
CAS 923863-82-5 is the registry number for 1-(2-(4-(Dimethylamino)phenyl)-4-methylthiazol-5-yl)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-[4-(dimethylamino)phenyl]-4-methyl-1,3-thiazol-5-yl]ethanone (CAS 923863-82-5) is a chemical compound with the molecular formula C14H16N2OS and a molecular weight of 260.36 g/mol. IUPAC name: 1-[2-[4-(dimethylamino)phenyl]-4-methyl-1,3-thiazol-5-yl]ethanone. InChIKey: RQGXJDPZJWXHNI-UHFFFAOYSA-N.
| Molecular formula | C14H16N2OS |
|---|---|
| Molecular weight | 260.36 g/mol |
| IUPAC name | 1-[2-[4-(dimethylamino)phenyl]-4-methyl-1,3-thiazol-5-yl]ethanone |
| InChIKey | RQGXJDPZJWXHNI-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC=C(C=C2)N(C)C)C(=O)C |
Computed by PubChem (NCBI)