CAS 923897-58-9 is the registry number for 4-(2-Chloroacetamido)-N-(3-sulfamoylphenyl)benzamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-[(2-chloroacetyl)amino]-N-(3-sulfamoylphenyl)benzamide (CAS 923897-58-9) is a chemical compound with the molecular formula C15H14ClN3O4S and a molecular weight of 367.8 g/mol. IUPAC name: 4-[(2-chloroacetyl)amino]-N-(3-sulfamoylphenyl)benzamide. InChIKey: XQYFIWJMUSLKJX-UHFFFAOYSA-N.
| Molecular formula | C15H14ClN3O4S |
|---|---|
| Molecular weight | 367.8 g/mol |
| IUPAC name | 4-[(2-chloroacetyl)amino]-N-(3-sulfamoylphenyl)benzamide |
| InChIKey | XQYFIWJMUSLKJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)NC(=O)C2=CC=C(C=C2)NC(=O)CCl |
Computed by PubChem (NCBI)