Products 923978-25-0
CAS 923978-25-0 is the registry number for O-Trimethyl GFT-505. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
Tert-butyl 2-[2,6-dimethyl-4-[(E)-3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]phenoxy]-2-methylpropanoate (CAS 923978-25-0) is a chemical compound with the molecular formula C26H32O4S and a molecular weight of 440.6 g/mol. IUPAC name: tert-butyl 2-[2,6-dimethyl-4-[(E)-3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]phenoxy]-2-methylpropanoate. InChIKey: YYPZICPPNBONPZ-NTEUORMPSA-N.
| Molecular formula | C26H32O4S |
|---|---|
| Molecular weight | 440.6 g/mol |
| IUPAC name | tert-butyl 2-[2,6-dimethyl-4-[(E)-3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]phenoxy]-2-methylpropanoate |
| InChIKey | YYPZICPPNBONPZ-NTEUORMPSA-N |
| SMILES | CC1=CC(=CC(=C1OC(C)(C)C(=O)OC(C)(C)C)C)/C=C/C(=O)C2=CC=C(C=C2)SC |
Computed by PubChem (NCBI)
Synonyms:
O-Trimethyl GFT-505