CAS 923978-27-2 appears in our catalog under these names: GFT-505, >95% (HPLC), Elafibranor/ 99.55% (existing batch purity), Elafibranor (GFT505), Elafibranor, Elafibranor 95%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 2mg, 5mg, 10mg, 25mg, 50mg.
2-[2,6-dimethyl-4-[(E)-3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]phenoxy]-2-methylpropanoic acid (CAS 923978-27-2) is a chemical compound with the molecular formula C22H24O4S and a molecular weight of 384.5 g/mol. IUPAC name: 2-[2,6-dimethyl-4-[(E)-3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]phenoxy]-2-methylpropanoic acid. InChIKey: AFLFKFHDSCQHOL-IZZDOVSWSA-N.
| Molecular formula | C22H24O4S |
|---|---|
| Molecular weight | 384.5 g/mol |
| IUPAC name | 2-[2,6-dimethyl-4-[(E)-3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]phenoxy]-2-methylpropanoic acid |
| InChIKey | AFLFKFHDSCQHOL-IZZDOVSWSA-N |
| SMILES | CC1=CC(=CC(=C1OC(C)(C)C(=O)O)C)/C=C/C(=O)C2=CC=C(C=C2)SC |
Computed by PubChem (NCBI)