CAS 924043-38-9 appears in our catalog under these names: 4-(2-Amino-1,3-thiazol-4-yl)-N,N-diethylbenzene-1-sulfonamide, 95%, 4-(2-Amino-1,3-thiazol-4-yl)-N,N-diethylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
4-(2-amino-1,3-thiazol-4-yl)-N,N-diethylbenzenesulfonamide (CAS 924043-38-9) is a chemical compound with the molecular formula C13H17N3O2S2 and a molecular weight of 311.4 g/mol. IUPAC name: 4-(2-amino-1,3-thiazol-4-yl)-N,N-diethylbenzenesulfonamide. InChIKey: MQVNBYUQZBKGPS-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O2S2 |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 4-(2-amino-1,3-thiazol-4-yl)-N,N-diethylbenzenesulfonamide |
| InChIKey | MQVNBYUQZBKGPS-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)