CAS 92425-18-8 appears in our catalog under these names: 1-(4-Bromophenyl)-5-phenyl-1H-1,2,4-triazole-3-carboxylic acid, 95%, 1-(4-Bromophenyl)-5-phenyl-1H-1,2,4-triazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(4-bromophenyl)-5-phenyl-1,2,4-triazole-3-carboxylic acid (CAS 92425-18-8) is a chemical compound with the molecular formula C15H10BrN3O2 and a molecular weight of 344.16 g/mol. IUPAC name: 1-(4-bromophenyl)-5-phenyl-1,2,4-triazole-3-carboxylic acid. InChIKey: UOOYHABNJZCNTP-UHFFFAOYSA-N.
| Molecular formula | C15H10BrN3O2 |
|---|---|
| Molecular weight | 344.16 g/mol |
| IUPAC name | 1-(4-bromophenyl)-5-phenyl-1,2,4-triazole-3-carboxylic acid |
| InChIKey | UOOYHABNJZCNTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NN2C3=CC=C(C=C3)Br)C(=O)O |
Computed by PubChem (NCBI)