Products 92433-42-6
CAS 92433-42-6 is the registry number for 7-Chloro-2-phenyl-2,3-dihydrobenzo[b][1,4]thiazepin-4(5H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one (CAS 92433-42-6) is a chemical compound with the molecular formula C15H12ClNOS and a molecular weight of 289.8 g/mol. IUPAC name: 7-chloro-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one. InChIKey: SWUMRDLJHPGOTA-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNOS |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | 7-chloro-2-phenyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| InChIKey | SWUMRDLJHPGOTA-UHFFFAOYSA-N |
| SMILES | C1C(SC2=C(C=C(C=C2)Cl)NC1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)