CAS 924636-93-1 is the registry number for AF3442. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(9-ethylcarbazol-3-yl)-2-(trifluoromethyl)benzamide (CAS 924636-93-1) is a chemical compound with the molecular formula C22H17F3N2O and a molecular weight of 382.4 g/mol. IUPAC name: N-(9-ethylcarbazol-3-yl)-2-(trifluoromethyl)benzamide. InChIKey: GHLDHBQXNPNZEI-UHFFFAOYSA-N.
| Molecular formula | C22H17F3N2O |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | N-(9-ethylcarbazol-3-yl)-2-(trifluoromethyl)benzamide |
| InChIKey | GHLDHBQXNPNZEI-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)NC(=O)C3=CC=CC=C3C(F)(F)F)C4=CC=CC=C41 |
Computed by PubChem (NCBI)