Products 92466-10-9

CAS 92466-10-9 is the registry number for Trt-Asp-Gly-OEt, 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-[[(2S)-4-amino-4-oxo-2-(tritylamino)butanoyl]amino]acetate (CAS 92466-10-9) is a chemical compound with the molecular formula C27H29N3O4 and a molecular weight of 459.5 g/mol. IUPAC name: ethyl 2-[[(2S)-4-amino-4-oxo-2-(tritylamino)butanoyl]amino]acetate. InChIKey: LYHMWJWZYQEIAG-QHCPKHFHSA-N.

Identity
Molecular formulaC27H29N3O4
Molecular weight459.5 g/mol
IUPAC nameethyl 2-[[(2S)-4-amino-4-oxo-2-(tritylamino)butanoyl]amino]acetate
InChIKeyLYHMWJWZYQEIAG-QHCPKHFHSA-N
SMILESCCOC(=O)CNC(=O)[C@H](CC(=O)N)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)