CAS 924713-00-8 is the registry number for 2-((4,5,6-Trimethylpyrimidin-2-yl)thio)propanamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanamide (CAS 924713-00-8) is a chemical compound with the molecular formula C10H15N3OS and a molecular weight of 225.31 g/mol. IUPAC name: 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanamide. InChIKey: MVVHZKPMRURBPK-UHFFFAOYSA-N.
| Molecular formula | C10H15N3OS |
|---|---|
| Molecular weight | 225.31 g/mol |
| IUPAC name | 2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylpropanamide |
| InChIKey | MVVHZKPMRURBPK-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(N=C1C)SC(C)C(=O)N)C |
Computed by PubChem (NCBI)