CAS 924718-94-5 is the registry number for 5-Chloro-2-fluoro-N-(5-methylthiazol-2-yl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)benzamide (CAS 924718-94-5) is a chemical compound with the molecular formula C11H8ClFN2OS and a molecular weight of 270.71 g/mol. IUPAC name: 5-chloro-2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)benzamide. InChIKey: ZEWKVCKOKKIDFF-UHFFFAOYSA-N.
| Molecular formula | C11H8ClFN2OS |
|---|---|
| Molecular weight | 270.71 g/mol |
| IUPAC name | 5-chloro-2-fluoro-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| InChIKey | ZEWKVCKOKKIDFF-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(S1)NC(=O)C2=C(C=CC(=C2)Cl)F |
Computed by PubChem (NCBI)