Products 92479-59-9
CAS 92479-59-9 appears in our catalog under these names: Lds 798, 97%, 4–((1E,3E)–4–(4–(Dimethylamino)phenyl)buta–1,3–dien–1–yl)–1–ethylquinolin–1–ium perchlorate. Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1g.
4-[(1E,3E)-4-(1-ethylquinolin-1-ium-4-yl)buta-1,3-dienyl]-N,N-dimethylaniline perchlorate (CAS 92479-59-9) is a chemical compound with the molecular formula C23H25ClN2O4 and a molecular weight of 428.9 g/mol. IUPAC name: 4-[(1E,3E)-4-(1-ethylquinolin-1-ium-4-yl)buta-1,3-dienyl]-N,N-dimethylaniline perchlorate. InChIKey: BLOOIVHLHVECMY-UHFFFAOYSA-M.
| Molecular formula | C23H25ClN2O4 |
|---|---|
| Molecular weight | 428.9 g/mol |
| IUPAC name | 4-[(1E,3E)-4-(1-ethylquinolin-1-ium-4-yl)buta-1,3-dienyl]-N,N-dimethylaniline perchlorate |
| InChIKey | BLOOIVHLHVECMY-UHFFFAOYSA-M |
| SMILES | CC[N+]1=CC=C(C2=CC=CC=C21)/C=C/C=C/C3=CC=C(C=C3)N(C)C.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)