CAS 114600-27-0 is the registry number for 3-Chlorobalipramine Maleate. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 50mg, 25mg, 100mg.
(Z)-but-2-enedioic acid;3-(2-chlorobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine (CAS 114600-27-0) is a chemical compound with the molecular formula C23H25ClN2O4 and a molecular weight of 428.9 g/mol. IUPAC name: (Z)-but-2-enedioic acid;3-(2-chlorobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine. InChIKey: CJSGBIUHDRDKSW-BTJKTKAUSA-N.
| Molecular formula | C23H25ClN2O4 |
|---|---|
| Molecular weight | 428.9 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;3-(2-chlorobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine |
| InChIKey | CJSGBIUHDRDKSW-BTJKTKAUSA-N |
| SMILES | CN(C)CCCN1C2=CC=CC=C2C=CC3=C1C=C(C=C3)Cl.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)