Products 924859-09-6

CAS 924859-09-6 is the registry number for Ethyl 3-morpholinocinnamate 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 3-morpholin-4-yl-1,1-dioxo-1-benzothiophene-2-carboxylate (CAS 924859-09-6) is a chemical compound with the molecular formula C15H17NO5S and a molecular weight of 323.4 g/mol. IUPAC name: ethyl 3-morpholin-4-yl-1,1-dioxo-1-benzothiophene-2-carboxylate. InChIKey: UIAZCFRGZNZKRT-UHFFFAOYSA-N.

Identity
Molecular formulaC15H17NO5S
Molecular weight323.4 g/mol
IUPAC nameethyl 3-morpholin-4-yl-1,1-dioxo-1-benzothiophene-2-carboxylate
InChIKeyUIAZCFRGZNZKRT-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C2=CC=CC=C2S1(=O)=O)N3CCOCC3

Computed by PubChem (NCBI)