Products 924859-49-4

CAS 924859-49-4 is the registry number for Ethyl 2,4-dichloro-5-(chlorosulfonyl)benzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 2,4-dichloro-5-chlorosulfonylbenzoate (CAS 924859-49-4) is a chemical compound with the molecular formula C9H7Cl3O4S and a molecular weight of 317.6 g/mol. IUPAC name: ethyl 2,4-dichloro-5-chlorosulfonylbenzoate. InChIKey: LLJLHKSMOAILHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7Cl3O4S
Molecular weight317.6 g/mol
IUPAC nameethyl 2,4-dichloro-5-chlorosulfonylbenzoate
InChIKeyLLJLHKSMOAILHJ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C(C=C1Cl)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)