CAS 924859-49-4 is the registry number for Ethyl 2,4-dichloro-5-(chlorosulfonyl)benzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Ethyl 2,4-dichloro-5-chlorosulfonylbenzoate (CAS 924859-49-4) is a chemical compound with the molecular formula C9H7Cl3O4S and a molecular weight of 317.6 g/mol. IUPAC name: ethyl 2,4-dichloro-5-chlorosulfonylbenzoate. InChIKey: LLJLHKSMOAILHJ-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl3O4S |
|---|---|
| Molecular weight | 317.6 g/mol |
| IUPAC name | ethyl 2,4-dichloro-5-chlorosulfonylbenzoate |
| InChIKey | LLJLHKSMOAILHJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)