CAS 924868-98-4 is the registry number for 5-Phenyl-2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
5-phenyl-2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-ol (CAS 924868-98-4) is a chemical compound with the molecular formula C16H10F3NOS and a molecular weight of 321.3 g/mol. IUPAC name: 5-phenyl-2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-ol. InChIKey: WASXEFAKRSPYPU-UHFFFAOYSA-N.
| Molecular formula | C16H10F3NOS |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | 5-phenyl-2-[3-(trifluoromethyl)phenyl]-1,3-thiazol-4-ol |
| InChIKey | WASXEFAKRSPYPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(S2)C3=CC(=CC=C3)C(F)(F)F)O |
Computed by PubChem (NCBI)