CAS 924869-07-8 is the registry number for 2-Hydrazino-1,3-benzothiazole-6-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-hydrazinyl-1,3-benzothiazole-6-carbohydrazide (CAS 924869-07-8) is a chemical compound with the molecular formula C8H9N5OS and a molecular weight of 223.26 g/mol. IUPAC name: 2-hydrazinyl-1,3-benzothiazole-6-carbohydrazide. InChIKey: JTWKTGKIUURTLG-UHFFFAOYSA-N.
| Molecular formula | C8H9N5OS |
|---|---|
| Molecular weight | 223.26 g/mol |
| IUPAC name | 2-hydrazinyl-1,3-benzothiazole-6-carbohydrazide |
| InChIKey | JTWKTGKIUURTLG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)NN)SC(=N2)NN |
Computed by PubChem (NCBI)