Products 924871-27-2
CAS 924871-27-2 is the registry number for Mtb-IN-9. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,4-dibromo-6-[3-(trifluoromethyl)-1,2-oxazol-5-yl]phenol (CAS 924871-27-2) is a chemical compound with the molecular formula C10H4Br2F3NO2 and a molecular weight of 386.95 g/mol. IUPAC name: 2,4-dibromo-6-[3-(trifluoromethyl)-1,2-oxazol-5-yl]phenol. InChIKey: UPPPIWMLZRPTQQ-UHFFFAOYSA-N.
| Molecular formula | C10H4Br2F3NO2 |
|---|---|
| Molecular weight | 386.95 g/mol |
| IUPAC name | 2,4-dibromo-6-[3-(trifluoromethyl)-1,2-oxazol-5-yl]phenol |
| InChIKey | UPPPIWMLZRPTQQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C2=CC(=NO2)C(F)(F)F)O)Br)Br |
Computed by PubChem (NCBI)