Products 925005-06-7
CAS 925005-06-7 is the registry number for 4-(3,5-Dimethylphenoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(3,5-dimethylphenoxy)benzoic acid (CAS 925005-06-7) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: 4-(3,5-dimethylphenoxy)benzoic acid. InChIKey: LEWICYODYSXXIA-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 4-(3,5-dimethylphenoxy)benzoic acid |
| InChIKey | LEWICYODYSXXIA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OC2=CC=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)