CAS 92503-45-2 is the registry number for 2-Amino-3-(methyl-d3)benzoic Acid. Offered by: TRC. Available pack sizes: 100mg.
2-amino-3-(trideuteriomethyl)benzoic acid (CAS 92503-45-2) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 154.18 g/mol. IUPAC name: 2-amino-3-(trideuteriomethyl)benzoic acid. InChIKey: WNAJXPYVTFYEST-FIBGUPNXSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 154.18 g/mol |
| IUPAC name | 2-amino-3-(trideuteriomethyl)benzoic acid |
| InChIKey | WNAJXPYVTFYEST-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=CC=C1)C(=O)O)N |
Computed by PubChem (NCBI)