CAS 925238-89-7 appears in our catalog under these names: JMV 2959, JMV 2959, 97%, JMV 2959, JMV 2959, 99%, 99%, JMV 2959, 99.91%. Offered by: TRC, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 500mg, 100mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 1mg, 2mg.
2-amino-N-[(1R)-2-(1H-indol-3-yl)-1-[4-[(4-methoxyphenyl)methyl]-5-(2-phenylethyl)-1,2,4-triazol-3-yl]ethyl]acetamide (CAS 925238-89-7) is a chemical compound with the molecular formula C30H32N6O2 and a molecular weight of 508.6 g/mol. IUPAC name: 2-amino-N-[(1R)-2-(1H-indol-3-yl)-1-[4-[(4-methoxyphenyl)methyl]-5-(2-phenylethyl)-1,2,4-triazol-3-yl]ethyl]acetamide. InChIKey: OZSZELOMMMKWTM-HHHXNRCGSA-N.
| Molecular formula | C30H32N6O2 |
|---|---|
| Molecular weight | 508.6 g/mol |
| IUPAC name | 2-amino-N-[(1R)-2-(1H-indol-3-yl)-1-[4-[(4-methoxyphenyl)methyl]-5-(2-phenylethyl)-1,2,4-triazol-3-yl]ethyl]acetamide |
| InChIKey | OZSZELOMMMKWTM-HHHXNRCGSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(=NN=C2[C@@H](CC3=CNC4=CC=CC=C43)NC(=O)CN)CCC5=CC=CC=C5 |
Computed by PubChem (NCBI)