CAS 92533-40-9 appears in our catalog under these names: Calcium L-aspartate hydrochloride, 98%, L-Aspartic Acid Calcium Salt Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10g, 1g.
Calcium;(2S)-2-aminobutanedioate;hydrochloride (CAS 92533-40-9) is a chemical compound with the molecular formula C4H6CaClNO4 and a molecular weight of 207.62 g/mol. IUPAC name: calcium;(2S)-2-aminobutanedioate;hydrochloride. InChIKey: LUUAAIHWKUJNKC-JIZZDEOASA-L.
| Molecular formula | C4H6CaClNO4 |
|---|---|
| Molecular weight | 207.62 g/mol |
| IUPAC name | calcium;(2S)-2-aminobutanedioate;hydrochloride |
| InChIKey | LUUAAIHWKUJNKC-JIZZDEOASA-L |
| SMILES | C([C@@H](C(=O)[O-])N)C(=O)[O-].Cl.[Ca+2] |
Computed by PubChem (NCBI)