CAS 925430-39-3 is the registry number for Phenylephrine Impurity 42. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1R)-2-chloro-1-hydroxyethyl]phenol (CAS 925430-39-3) is a chemical compound with the molecular formula C8H9ClO2 and a molecular weight of 172.61 g/mol. IUPAC name: 3-[(1R)-2-chloro-1-hydroxyethyl]phenol. InChIKey: CLHYCWXPCNBCSH-QMMMGPOBSA-N.
| Molecular formula | C8H9ClO2 |
|---|---|
| Molecular weight | 172.61 g/mol |
| IUPAC name | 3-[(1R)-2-chloro-1-hydroxyethyl]phenol |
| InChIKey | CLHYCWXPCNBCSH-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)O)[C@H](CCl)O |
Computed by PubChem (NCBI)