CAS 92545-85-2 appears in our catalog under these names: 6-(4-Bromophenyl)imidazo(2,1-b)thiazol-5-amine, 95+%, 6-(4-Bromophenyl)imidazo(2,1-b)(1,3)thiazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-(4-bromophenyl)imidazo[2,1-b][1,3]thiazol-5-amine (CAS 92545-85-2) is a chemical compound with the molecular formula C11H8BrN3S and a molecular weight of 294.17 g/mol. IUPAC name: 6-(4-bromophenyl)imidazo[2,1-b][1,3]thiazol-5-amine. InChIKey: XUJMDJZPQHVRIC-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN3S |
|---|---|
| Molecular weight | 294.17 g/mol |
| IUPAC name | 6-(4-bromophenyl)imidazo[2,1-b][1,3]thiazol-5-amine |
| InChIKey | XUJMDJZPQHVRIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N3C=CSC3=N2)N)Br |
Computed by PubChem (NCBI)