CAS 92555-69-6 appears in our catalog under these names: N-(4-Phenoxyphenyl)-1,3,5-triazine-2,4-diamine, 95%, N2-(4-Phenoxyphenyl)-1,3,5-triazine-2,4-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-N-(4-phenoxyphenyl)-1,3,5-triazine-2,4-diamine (CAS 92555-69-6) is a chemical compound with the molecular formula C15H13N5O and a molecular weight of 279.30 g/mol. IUPAC name: 2-N-(4-phenoxyphenyl)-1,3,5-triazine-2,4-diamine. InChIKey: KHVFYTGMCVAGIT-UHFFFAOYSA-N.
| Molecular formula | C15H13N5O |
|---|---|
| Molecular weight | 279.30 g/mol |
| IUPAC name | 2-N-(4-phenoxyphenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | KHVFYTGMCVAGIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)NC3=NC=NC(=N3)N |
Computed by PubChem (NCBI)