Products 92562-94-2
CAS 92562-94-2 appears in our catalog under these names: 3′-Azido-ddATP, 3'–Azido–ddATP 100mM Sodium Solution. Offered by: MedChemExpress, GLPBio. Available pack sizes: Get quote, 10ul (100mM), 50ul (100mM), 100ul (100mM).
[[(2S,3S,5R)-5-(6-aminopurin-9-yl)-3-azidooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (CAS 92562-94-2) is a chemical compound with the molecular formula C10H15N8O11P3 and a molecular weight of 516.20 g/mol. IUPAC name: [[(2S,3S,5R)-5-(6-aminopurin-9-yl)-3-azidooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate. InChIKey: ZSSWGIDWWUCZJK-RRKCRQDMSA-N.
| Molecular formula | C10H15N8O11P3 |
|---|---|
| Molecular weight | 516.20 g/mol |
| IUPAC name | [[(2S,3S,5R)-5-(6-aminopurin-9-yl)-3-azidooxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| InChIKey | ZSSWGIDWWUCZJK-RRKCRQDMSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)