Products 925703-75-9
CAS 925703-75-9 is the registry number for OT antagonist 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,3-dimethylphenoxy)-5-[4-(6-methoxy-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]pyrazine (CAS 925703-75-9) is a chemical compound with the molecular formula C21H20N6O2 and a molecular weight of 388.4 g/mol. IUPAC name: 2-(2,3-dimethylphenoxy)-5-[4-(6-methoxy-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]pyrazine. InChIKey: CYLJCMVSRQKHMP-UHFFFAOYSA-N.
| Molecular formula | C21H20N6O2 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 2-(2,3-dimethylphenoxy)-5-[4-(6-methoxy-3-pyridinyl)-5-methyl-1,2,4-triazol-3-yl]pyrazine |
| InChIKey | CYLJCMVSRQKHMP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)OC2=NC=C(N=C2)C3=NN=C(N3C4=CN=C(C=C4)OC)C)C |
Computed by PubChem (NCBI)
Synonyms:
OT antagonist 3, orb1708961