Products 925905-07-3
CAS 925905-07-3 appears in our catalog under these names: 4-(2,3-Dihydro-1h-indol-1-ylmethyl)aniline, 95%, 4-(2,3-Dihydro-1H-indol-1-ylmethyl)aniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-(2,3-dihydroindol-1-ylmethyl)aniline (CAS 925905-07-3) is a chemical compound with the molecular formula C15H16N2 and a molecular weight of 224.30 g/mol. IUPAC name: 4-(2,3-dihydroindol-1-ylmethyl)aniline. InChIKey: YRCYUXVUZBJHOT-UHFFFAOYSA-N.
| Molecular formula | C15H16N2 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | 4-(2,3-dihydroindol-1-ylmethyl)aniline |
| InChIKey | YRCYUXVUZBJHOT-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)CC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)