CAS 925932-71-4 appears in our catalog under these names: 3-(N-BOC-N-Butylamino)phenylboronic acid, 98%, 3-(N-BOC-N-BUTYLAMINO)PHENYLBORONIC ACID, 98%, 98%, (3-((tert-Butoxycarbonyl)(butyl)amino)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg, 25g.
[3-[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid (CAS 925932-71-4) is a chemical compound with the molecular formula C15H24BNO4 and a molecular weight of 293.17 g/mol. IUPAC name: [3-[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid. InChIKey: PWGLYYWIKQFCSS-UHFFFAOYSA-N.
| Molecular formula | C15H24BNO4 |
|---|---|
| Molecular weight | 293.17 g/mol |
| IUPAC name | [3-[butyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid |
| InChIKey | PWGLYYWIKQFCSS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N(CCCC)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)